CAS 1227602-97-2 appears in our catalog under these names: 3-Iodo-6-(trifluoromethyl)pyridin-2-amine, 2-Amino-3-iodo-6-(trifluoromethyl)pyridine, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
3-iodo-6-(trifluoromethyl)pyridin-2-amine (CAS 1227602-97-2) is a chemical compound with the molecular formula C6H4F3IN2 and a molecular weight of 288.01 g/mol. IUPAC name: 3-iodo-6-(trifluoromethyl)pyridin-2-amine. InChIKey: YRIMQSWLFUPHIK-UHFFFAOYSA-N.
| Molecular formula | C6H4F3IN2 |
|---|---|
| Molecular weight | 288.01 g/mol |
| IUPAC name | 3-iodo-6-(trifluoromethyl)pyridin-2-amine |
| InChIKey | YRIMQSWLFUPHIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1I)N)C(F)(F)F |
Computed by PubChem (NCBI)