Products 1227626-51-8
CAS 1227626-51-8 appears in our catalog under these names: Olmesartan Medoxomil Impurity 87, Olmesartan Impurity 27, Olmesartan Impurity 26, N-Trityl Des-4-hydroxy Olmesartan Medoxomil, Trityl olmesartan medoxomil impurity III. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 5-prop-1-en-2-yl-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (CAS 1227626-51-8) is a chemical compound with the molecular formula C48H42N6O5 and a molecular weight of 782.9 g/mol. IUPAC name: (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 5-prop-1-en-2-yl-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate. InChIKey: YQJFAQFEAOEJFL-UHFFFAOYSA-N.
| Molecular formula | C48H42N6O5 |
|---|---|
| Molecular weight | 782.9 g/mol |
| IUPAC name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 5-prop-1-en-2-yl-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| InChIKey | YQJFAQFEAOEJFL-UHFFFAOYSA-N |
| SMILES | CCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NN=NN4C(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7)C(=O)OCC8=C(OC(=O)O8)C)C(=C)C |
Computed by PubChem (NCBI)