CAS 1227635-07-5 is the registry number for 4-(2-((2-chloro-9-isopropyl-9H-purin-6-yl)aMino)ethyl)phenol, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[2-[(2-chloro-9-propan-2-ylpurin-6-yl)amino]ethyl]phenol (CAS 1227635-07-5) is a chemical compound with the molecular formula C16H18ClN5O and a molecular weight of 331.80 g/mol. IUPAC name: 4-[2-[(2-chloro-9-propan-2-ylpurin-6-yl)amino]ethyl]phenol. InChIKey: XSUREAGNPJJHSQ-UHFFFAOYSA-N.
| Molecular formula | C16H18ClN5O |
|---|---|
| Molecular weight | 331.80 g/mol |
| IUPAC name | 4-[2-[(2-chloro-9-propan-2-ylpurin-6-yl)amino]ethyl]phenol |
| InChIKey | XSUREAGNPJJHSQ-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=NC2=C(N=C(N=C21)Cl)NCCC3=CC=C(C=C3)O |
Computed by PubChem (NCBI)