CAS 122775-18-2 is the registry number for 3-Hydroxy-propanenitrile-2,2,3,3-d4. Offered by: TRC. Available pack sizes: 50mg.
2,2,3,3-tetradeuterio-3-hydroxypropanenitrile (CAS 122775-18-2) is a chemical compound with the molecular formula C3H5NO and a molecular weight of 75.10 g/mol. IUPAC name: 2,2,3,3-tetradeuterio-3-hydroxypropanenitrile. InChIKey: WSGYTJNNHPZFKR-VEPVEJTGSA-N.
| Molecular formula | C3H5NO |
|---|---|
| Molecular weight | 75.10 g/mol |
| IUPAC name | 2,2,3,3-tetradeuterio-3-hydroxypropanenitrile |
| InChIKey | WSGYTJNNHPZFKR-VEPVEJTGSA-N |
| SMILES | [2H]C([2H])(C#N)C([2H])([2H])O |
Computed by PubChem (NCBI)