CAS 122775-20-6 appears in our catalog under these names: 2-Chloroacetamide-d4, >95% (HPLC), 2-Chloroacetamide-d4, 99 atom % D, min 98% Chemical Purity, 2-Chloroacetamide-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,25g, 0,1g, 25 mg, 5 mg, 10 mg.
2-chloro-N,N,2,2-tetradeuterioacetamide (CAS 122775-20-6) is a chemical compound with the molecular formula C2H4ClNO and a molecular weight of 97.54 g/mol. IUPAC name: 2-chloro-N,N,2,2-tetradeuterioacetamide. InChIKey: VXIVSQZSERGHQP-BGOGGDMHSA-N.
| Molecular formula | C2H4ClNO |
|---|---|
| Molecular weight | 97.54 g/mol |
| IUPAC name | 2-chloro-N,N,2,2-tetradeuterioacetamide |
| InChIKey | VXIVSQZSERGHQP-BGOGGDMHSA-N |
| SMILES | [2H]C([2H])(C(=O)N([2H])[2H])Cl |
Computed by PubChem (NCBI)