CAS 1227955-22-7 is the registry number for 3,5-Dichloro-4-([3-(trifluoromethyl)pyridin-2-yl]oxy)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3,5-dichloro-4-[[3-(trifluoromethyl)-2-pyridinyl]oxy]aniline (CAS 1227955-22-7) is a chemical compound with the molecular formula C12H7Cl2F3N2O and a molecular weight of 323.09 g/mol. IUPAC name: 3,5-dichloro-4-[[3-(trifluoromethyl)-2-pyridinyl]oxy]aniline. InChIKey: XNPBYWGMWIJYGT-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2F3N2O |
|---|---|
| Molecular weight | 323.09 g/mol |
| IUPAC name | 3,5-dichloro-4-[[3-(trifluoromethyl)-2-pyridinyl]oxy]aniline |
| InChIKey | XNPBYWGMWIJYGT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OC2=C(C=C(C=C2Cl)N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)