CAS 1227958-56-6 appears in our catalog under these names: 6–Bromo–8–(2,6–dichlorophenyl)–9H–purine, 6-Bromo-8-(2,6-dichlorophenyl)-9h-purine, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-8-(2,6-dichlorophenyl)-7H-purine (CAS 1227958-56-6) is a chemical compound with the molecular formula C11H5BrCl2N4 and a molecular weight of 343.99 g/mol. IUPAC name: 6-bromo-8-(2,6-dichlorophenyl)-7H-purine. InChIKey: CPHQYGWOXFTDEY-UHFFFAOYSA-N.
| Molecular formula | C11H5BrCl2N4 |
|---|---|
| Molecular weight | 343.99 g/mol |
| IUPAC name | 6-bromo-8-(2,6-dichlorophenyl)-7H-purine |
| InChIKey | CPHQYGWOXFTDEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=NC3=C(N2)C(=NC=N3)Br)Cl |
Computed by PubChem (NCBI)