Products 1228029-77-3
CAS 1228029-77-3 is the registry number for (3aS，4S，6aR)–2–benzyloctahydrocyclopenta(c)pyrrol–4–ol. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
(3aS,4S,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol (CAS 1228029-77-3) is a chemical compound with the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. IUPAC name: (3aS,4S,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol. InChIKey: QVQHJPYWCKXTFP-MJBXVCDLSA-N.
| Molecular formula | C14H19NO |
|---|---|
| Molecular weight | 217.31 g/mol |
| IUPAC name | (3aS,4S,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol |
| InChIKey | QVQHJPYWCKXTFP-MJBXVCDLSA-N |
| SMILES | C1C[C@@H]([C@H]2[C@@H]1CN(C2)CC3=CC=CC=C3)O |
Computed by PubChem (NCBI)