CAS 1228033-52-0 appears in our catalog under these names: (S)-1-phenyl-1-((R)-pyrrolidin-2-yl)ethanol, 95%, 95%, (1S)-1-PHENYL-1-[(2R)-PYRROLIDIN-2-YL]ETHAN-1-OL, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(1S)-1-phenyl-1-[(2R)-pyrrolidin-2-yl]ethanol (CAS 1228033-52-0) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: (1S)-1-phenyl-1-[(2R)-pyrrolidin-2-yl]ethanol. InChIKey: CMBFPAOCIMBCTJ-NEPJUHHUSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | (1S)-1-phenyl-1-[(2R)-pyrrolidin-2-yl]ethanol |
| InChIKey | CMBFPAOCIMBCTJ-NEPJUHHUSA-N |
| SMILES | C[C@@]([C@H]1CCCN1)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)