CAS 1228108-61-9 is the registry number for rel-(3R,4S)-1-Benzyl-4-(4-(trifluoromethoxy)phenyl)pyrrolidin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-1-benzyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-amine (CAS 1228108-61-9) is a chemical compound with the molecular formula C18H19F3N2O and a molecular weight of 336.4 g/mol. IUPAC name: (3R,4S)-1-benzyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-amine. InChIKey: XENQPTNYMSJSNO-SJORKVTESA-N.
| Molecular formula | C18H19F3N2O |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | (3R,4S)-1-benzyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-amine |
| InChIKey | XENQPTNYMSJSNO-SJORKVTESA-N |
| SMILES | C1[C@@H]([C@H](CN1CC2=CC=CC=C2)N)C3=CC=C(C=C3)OC(F)(F)F |
Computed by PubChem (NCBI)