CAS 1228153-91-0 appears in our catalog under these names: 5'–Fluoro–N–phenyl–(1,1':3',1''–terphenyl)–4'–amine, 5'-Fluoro-N-phenyl-[1,1':3',1''-terphenyl]-4'-amine, >98.0%(HPLC)(N), 5'-Fluoro-N-phenyl-[1,1':3',1''-terphenyl]-4'-amine, ≥98%, ≥98%, 5'-FLUORO-N-PHENYL-[1,1':3',1''-TERPHENYL]-4'-AMINE, 95%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 50mg, 200mg.
2-fluoro-N,4,6-triphenylaniline (CAS 1228153-91-0) is a chemical compound with the molecular formula C24H18FN and a molecular weight of 339.4 g/mol. IUPAC name: 2-fluoro-N,4,6-triphenylaniline. InChIKey: USTXPBYMOJRABI-UHFFFAOYSA-N.
| Molecular formula | C24H18FN |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 2-fluoro-N,4,6-triphenylaniline |
| InChIKey | USTXPBYMOJRABI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C(=C2)F)NC3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)