CAS 1228182-52-2 is the registry number for Dimethachlor Metabolite SYN 528702 sodium salt, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x1ml.
Sodium 2-hydroxy-3-[2-(N-(2-hydroxyacetyl)-2,6-dimethylanilino)ethylsulfanyl]propanoate (CAS 1228182-52-2) is a chemical compound with the molecular formula C15H20NNaO5S and a molecular weight of 349.4 g/mol. IUPAC name: sodium 2-hydroxy-3-[2-(N-(2-hydroxyacetyl)-2,6-dimethylanilino)ethylsulfanyl]propanoate. InChIKey: AVSNXORCABRXGJ-UHFFFAOYSA-M.
| Molecular formula | C15H20NNaO5S |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | sodium 2-hydroxy-3-[2-(N-(2-hydroxyacetyl)-2,6-dimethylanilino)ethylsulfanyl]propanoate |
| InChIKey | AVSNXORCABRXGJ-UHFFFAOYSA-M |
| SMILES | CC1=C(C(=CC=C1)C)N(CCSCC(C(=O)[O-])O)C(=O)CO.[Na+] |
Computed by PubChem (NCBI)