Products 1228182-53-3
CAS 1228182-53-3 appears in our catalog under these names: Xylazine–d6, Xylazine–d6 (CRM), D6-Xylazine, ISO 17034 RM, D6-Xylazine, 100 µg/ml in Acetonitrile, ISO 17034 CRM, Xylazine-D6. Offered by: GLPBio, HPC Standards, Supelco, Sigma-Aldrich. Available pack sizes: 1mg, 5mg, 10mg, 1ml.
N-[2,6-bis(trideuteriomethyl)phenyl]-5,6-dihydro-4H-1,3-thiazin-2-amine (CAS 1228182-53-3) is a chemical compound with the molecular formula C12H16N2S and a molecular weight of 226.37 g/mol. IUPAC name: N-[2,6-bis(trideuteriomethyl)phenyl]-5,6-dihydro-4H-1,3-thiazin-2-amine. InChIKey: BPICBUSOMSTKRF-WFGJKAKNSA-N.
| Molecular formula | C12H16N2S |
|---|---|
| Molecular weight | 226.37 g/mol |
| IUPAC name | N-[2,6-bis(trideuteriomethyl)phenyl]-5,6-dihydro-4H-1,3-thiazin-2-amine |
| InChIKey | BPICBUSOMSTKRF-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=CC=C1)C([2H])([2H])[2H])NC2=NCCCS2 |
Computed by PubChem (NCBI)