CAS 1228392-59-3 appears in our catalog under these names: Di-tert-butyl 4-bromo-2-nitrophenyliminodicarbonate, 95%, Di-tert-butyl (4-bromo-2-nitrophenyl)iminodicarbonate. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 100mg, 250mg.
Tert-butyl N-(4-bromo-2-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 1228392-59-3) is a chemical compound with the molecular formula C16H21BrN2O6 and a molecular weight of 417.25 g/mol. IUPAC name: tert-butyl N-(4-bromo-2-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: CPVNSGCXUGJJOL-UHFFFAOYSA-N.
| Molecular formula | C16H21BrN2O6 |
|---|---|
| Molecular weight | 417.25 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-2-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | CPVNSGCXUGJJOL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=C(C=C(C=C1)Br)[N+](=O)[O-])C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)