CAS 122841-09-2 is the registry number for L 722151. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(5-methyl-[1,3]thiazolo[2,3-b][1,3,4]thiadiazol-4-ium-2-yl)sulfanyl]propan-2-one perchlorate (CAS 122841-09-2) is a chemical compound with the molecular formula C8H9ClN2O5S3 and a molecular weight of 344.8 g/mol. IUPAC name: 1-[(5-methyl-[1,3]thiazolo[2,3-b][1,3,4]thiadiazol-4-ium-2-yl)sulfanyl]propan-2-one perchlorate. InChIKey: VDKILYNGSUZCJQ-UHFFFAOYSA-M.
| Molecular formula | C8H9ClN2O5S3 |
|---|---|
| Molecular weight | 344.8 g/mol |
| IUPAC name | 1-[(5-methyl-[1,3]thiazolo[2,3-b][1,3,4]thiadiazol-4-ium-2-yl)sulfanyl]propan-2-one perchlorate |
| InChIKey | VDKILYNGSUZCJQ-UHFFFAOYSA-M |
| SMILES | CC1=CSC2=[N+]1N=C(S2)SCC(=O)C.[O-]Cl(=O)(=O)=O |
Computed by PubChem (NCBI)