CAS 1228439-71-1 appears in our catalog under these names: (+)-KCC2 blocker 1, (+)-KCC2 blocker 1, 98.68%, (+)-KCC2 blocker 1/ 98.12% (existing batch purity). Offered by: Chemat, MedChemExpress, TargetMol. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 50 mg.
Benzyl 1-acetyl-2-[(4-methylsulfonylphenyl)methyl]pyrrolidine-2-carboxylate (CAS 1228439-71-1) is a chemical compound with the molecular formula C22H25NO5S and a molecular weight of 415.5 g/mol. IUPAC name: benzyl 1-acetyl-2-[(4-methylsulfonylphenyl)methyl]pyrrolidine-2-carboxylate. InChIKey: XFXZWVGQXNFWDE-UHFFFAOYSA-N.
| Molecular formula | C22H25NO5S |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | benzyl 1-acetyl-2-[(4-methylsulfonylphenyl)methyl]pyrrolidine-2-carboxylate |
| InChIKey | XFXZWVGQXNFWDE-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCCC1(CC2=CC=C(C=C2)S(=O)(=O)C)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)