Products 1228530-96-8
CAS 1228530-96-8 is the registry number for (1R,4S,6R)-2-Oxo-3-azabicyclo[4.1.0]heptane-4-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,4S,6R)-4-(hydroxymethyl)-3-azabicyclo[4.1.0]heptan-2-one (CAS 1228530-96-8) is a chemical compound with the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. IUPAC name: (1R,4S,6R)-4-(hydroxymethyl)-3-azabicyclo[4.1.0]heptan-2-one. InChIKey: VGNYKLGDWGYNBO-HCWXCVPCSA-N.
| Molecular formula | C7H11NO2 |
|---|---|
| Molecular weight | 141.17 g/mol |
| IUPAC name | (1R,4S,6R)-4-(hydroxymethyl)-3-azabicyclo[4.1.0]heptan-2-one |
| InChIKey | VGNYKLGDWGYNBO-HCWXCVPCSA-N |
| SMILES | C1[C@H]2C[C@H]2C(=O)N[C@@H]1CO |
Computed by PubChem (NCBI)