CAS 1228552-02-0 appears in our catalog under these names: Bendamustine Impurity 27, Bendamustine USP Related Compound B, Bendamustine Ether Impurity, Bendamustine Impurity 11(Bendamustine USP RC B), Bendamustine Impurity 27-d3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-(1-methyl-5-morpholin-4-ylbenzimidazol-2-yl)butanoic acid (CAS 1228552-02-0) is a chemical compound with the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. IUPAC name: 4-(1-methyl-5-morpholin-4-ylbenzimidazol-2-yl)butanoic acid. InChIKey: SEJQBOGHXQJRBF-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O3 |
|---|---|
| Molecular weight | 303.36 g/mol |
| IUPAC name | 4-(1-methyl-5-morpholin-4-ylbenzimidazol-2-yl)butanoic acid |
| InChIKey | SEJQBOGHXQJRBF-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)N3CCOCC3)N=C1CCCC(=O)O |
Computed by PubChem (NCBI)