CAS 1228552-48-4 is the registry number for N-(2,4-Dibromo-6-nitrophenyl)-s,s-dimethylsulfoximine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(2,4-dibromo-6-nitrophenyl)imino-dimethyl-oxo-lambda6-sulfane (CAS 1228552-48-4) is a chemical compound with the molecular formula C8H8Br2N2O3S and a molecular weight of 372.04 g/mol. IUPAC name: (2,4-dibromo-6-nitrophenyl)imino-dimethyl-oxo-lambda6-sulfane. InChIKey: ZRAZOPCXEHHGAK-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2N2O3S |
|---|---|
| Molecular weight | 372.04 g/mol |
| IUPAC name | (2,4-dibromo-6-nitrophenyl)imino-dimethyl-oxo-lambda6-sulfane |
| InChIKey | ZRAZOPCXEHHGAK-UHFFFAOYSA-N |
| SMILES | CS(=NC1=C(C=C(C=C1Br)Br)[N+](=O)[O-])(=O)C |
Computed by PubChem (NCBI)