Products 1228571-79-6
CAS 1228571-79-6 is the registry number for (S)-1-(4-Chloro-2-fluorophenyl)ethan-1-amine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(4-chloro-2-fluorophenyl)ethanamine (CAS 1228571-79-6) is a chemical compound with the molecular formula C8H9ClFN and a molecular weight of 173.61 g/mol. IUPAC name: (1S)-1-(4-chloro-2-fluorophenyl)ethanamine. InChIKey: SDXKAEMBENYOFO-YFKPBYRVSA-N.
| Molecular formula | C8H9ClFN |
|---|---|
| Molecular weight | 173.61 g/mol |
| IUPAC name | (1S)-1-(4-chloro-2-fluorophenyl)ethanamine |
| InChIKey | SDXKAEMBENYOFO-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1)Cl)F)N |
Computed by PubChem (NCBI)