CAS 1228571-89-8 appears in our catalog under these names: (S)-2-(1-Aminoethyl)-4-bromophenol 95%, 2-[(1S)-1-aminoethyl]-4-bromophenol, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
2-[(1S)-1-aminoethyl]-4-bromophenol (CAS 1228571-89-8) is a chemical compound with the molecular formula C8H10BrNO and a molecular weight of 216.07 g/mol. IUPAC name: 2-[(1S)-1-aminoethyl]-4-bromophenol. InChIKey: WPXYTMUWZPNGLQ-YFKPBYRVSA-N.
| Molecular formula | C8H10BrNO |
|---|---|
| Molecular weight | 216.07 g/mol |
| IUPAC name | 2-[(1S)-1-aminoethyl]-4-bromophenol |
| InChIKey | WPXYTMUWZPNGLQ-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=C(C=CC(=C1)Br)O)N |
Computed by PubChem (NCBI)