CAS 1228595-79-6 appears in our catalog under these names: 3,7–Dibromo–5,5–dimethyl–5H–dibenzo(b,d)silole, 3,7-Dibromo-5,5-dimethyl-5H-dibenzo[b,d]silole, 95%, 95%, 3,7-Dibromo-5,5-dimethyl-5H-dibenzo[b,d]silole, 98%, 3,7-Dibromo-5,5-dimethyl-5H-dibenzo[b,d]silole, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
3,7-dibromo-5,5-dimethylbenzo[b][1]benzosilole (CAS 1228595-79-6) is a chemical compound with the molecular formula C14H12Br2Si and a molecular weight of 368.14 g/mol. IUPAC name: 3,7-dibromo-5,5-dimethylbenzo[b][1]benzosilole. InChIKey: FAJDSWHVALMLLF-UHFFFAOYSA-N.
| Molecular formula | C14H12Br2Si |
|---|---|
| Molecular weight | 368.14 g/mol |
| IUPAC name | 3,7-dibromo-5,5-dimethylbenzo[b][1]benzosilole |
| InChIKey | FAJDSWHVALMLLF-UHFFFAOYSA-N |
| SMILES | C[Si]1(C2=C(C=CC(=C2)Br)C3=C1C=C(C=C3)Br)C |
Computed by PubChem (NCBI)