Products 1228656-08-3
CAS 1228656-08-3 appears in our catalog under these names: Aminocaproic Acid-d6, Aminocaproic-d6 Acid, 6-Aminohexanoic Acid-d6, 6–Aminocaproic acid–d6, 6-Aminocaproic acid-d6, 99.93%. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 1 mg.
6-amino-3,3,4,4,5,5-hexadeuteriohexanoic acid (CAS 1228656-08-3) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 137.21 g/mol. IUPAC name: 6-amino-3,3,4,4,5,5-hexadeuteriohexanoic acid. InChIKey: SLXKOJJOQWFEFD-NMFSSPJFSA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 137.21 g/mol |
| IUPAC name | 6-amino-3,3,4,4,5,5-hexadeuteriohexanoic acid |
| InChIKey | SLXKOJJOQWFEFD-NMFSSPJFSA-N |
| SMILES | [2H]C([2H])(CC(=O)O)C([2H])([2H])C([2H])([2H])CN |
Computed by PubChem (NCBI)