CAS 1228665-73-3 is the registry number for 5-Fluoro-4-(trimethylsilyl)-1h-pyrrolo[2,3-b]-pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(5-fluoro-1H-pyrrolo[2,3-b]pyridin-4-yl)-trimethylsilane (CAS 1228665-73-3) is a chemical compound with the molecular formula C10H13FN2Si and a molecular weight of 208.31 g/mol. IUPAC name: (5-fluoro-1H-pyrrolo[2,3-b]pyridin-4-yl)-trimethylsilane. InChIKey: HTTKHFGDRKTCMS-UHFFFAOYSA-N.
| Molecular formula | C10H13FN2Si |
|---|---|
| Molecular weight | 208.31 g/mol |
| IUPAC name | (5-fluoro-1H-pyrrolo[2,3-b]pyridin-4-yl)-trimethylsilane |
| InChIKey | HTTKHFGDRKTCMS-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C2C=CNC2=NC=C1F |
Computed by PubChem (NCBI)