CAS 1228665-74-4 appears in our catalog under these names: 5-Bromo-2-(trimethylsilyl)furo[2,3-b]pyridine, 95%, 5-Bromo-2-(trimethylsilyl)furo(2,3-b)pyridine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(5-bromofuro[2,3-b]pyridin-2-yl)-trimethylsilane (CAS 1228665-74-4) is a chemical compound with the molecular formula C10H12BrNOSi and a molecular weight of 270.20 g/mol. IUPAC name: (5-bromofuro[2,3-b]pyridin-2-yl)-trimethylsilane. InChIKey: XVBPLCGYJFHHSE-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNOSi |
|---|---|
| Molecular weight | 270.20 g/mol |
| IUPAC name | (5-bromofuro[2,3-b]pyridin-2-yl)-trimethylsilane |
| InChIKey | XVBPLCGYJFHHSE-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC2=CC(=CN=C2O1)Br |
Computed by PubChem (NCBI)