Products 1228665-84-6

CAS 1228665-84-6 is the registry number for tert-Butyl 4-chloro-2-(3-hydroxyprop-1-ynyl)-pyridin-3-yl carbonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl [4-chloro-2-(3-hydroxyprop-1-ynyl)-3-pyridinyl] carbonate (CAS 1228665-84-6) is a chemical compound with the molecular formula C13H14ClNO4 and a molecular weight of 283.71 g/mol. IUPAC name: tert-butyl [4-chloro-2-(3-hydroxyprop-1-ynyl)-3-pyridinyl] carbonate. InChIKey: URKSQFHYXFJOAW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14ClNO4
Molecular weight283.71 g/mol
IUPAC nametert-butyl [4-chloro-2-(3-hydroxyprop-1-ynyl)-3-pyridinyl] carbonate
InChIKeyURKSQFHYXFJOAW-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)OC1=C(C=CN=C1C#CCO)Cl

Computed by PubChem (NCBI)