CAS 1228666-13-4 is the registry number for N-(3-Iodo-5-methylpyridin-2-yl)pivalamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-(3-iodo-5-methyl-2-pyridinyl)-2,2-dimethylpropanamide (CAS 1228666-13-4) is a chemical compound with the molecular formula C11H15IN2O and a molecular weight of 318.15 g/mol. IUPAC name: N-(3-iodo-5-methyl-2-pyridinyl)-2,2-dimethylpropanamide. InChIKey: MXMPHGVEQNSATQ-UHFFFAOYSA-N.
| Molecular formula | C11H15IN2O |
|---|---|
| Molecular weight | 318.15 g/mol |
| IUPAC name | N-(3-iodo-5-methyl-2-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | MXMPHGVEQNSATQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)NC(=O)C(C)(C)C)I |
Computed by PubChem (NCBI)