CAS 1228757-38-7 is the registry number for 2-((Bromotriphenylphosphoranyl)methyl)pyridine, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Bromo-triphenyl-(pyridin-2-ylmethyl)-lambda5-phosphane (CAS 1228757-38-7) is a chemical compound with the molecular formula C24H21BrNP and a molecular weight of 434.3 g/mol. IUPAC name: bromo-triphenyl-(pyridin-2-ylmethyl)-lambda5-phosphane. InChIKey: SNDLNEPHRNDPMU-UHFFFAOYSA-N.
| Molecular formula | C24H21BrNP |
|---|---|
| Molecular weight | 434.3 g/mol |
| IUPAC name | bromo-triphenyl-(pyridin-2-ylmethyl)-lambda5-phosphane |
| InChIKey | SNDLNEPHRNDPMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(CC2=CC=CC=N2)(C3=CC=CC=C3)(C4=CC=CC=C4)Br |
Computed by PubChem (NCBI)