CAS 1228774-41-1 is the registry number for 4,4-Difluoro-1-[(3-iodophenyl)carbonyl]piperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(4,4-difluoropiperidin-1-yl)-(3-iodophenyl)methanone (CAS 1228774-41-1) is a chemical compound with the molecular formula C12H12F2INO and a molecular weight of 351.13 g/mol. IUPAC name: (4,4-difluoropiperidin-1-yl)-(3-iodophenyl)methanone. InChIKey: WANKUXPMVWZVEQ-UHFFFAOYSA-N.
| Molecular formula | C12H12F2INO |
|---|---|
| Molecular weight | 351.13 g/mol |
| IUPAC name | (4,4-difluoropiperidin-1-yl)-(3-iodophenyl)methanone |
| InChIKey | WANKUXPMVWZVEQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(F)F)C(=O)C2=CC(=CC=C2)I |
Computed by PubChem (NCBI)