CAS 1228778-19-5 is the registry number for 1-[(5-Iodo-2-methylphenyl)carbonyl]pyrrolidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(5-iodo-2-methylphenyl)-pyrrolidin-1-ylmethanone (CAS 1228778-19-5) is a chemical compound with the molecular formula C12H14INO and a molecular weight of 315.15 g/mol. IUPAC name: (5-iodo-2-methylphenyl)-pyrrolidin-1-ylmethanone. InChIKey: HBQMCKIVMYXBSM-UHFFFAOYSA-N.
| Molecular formula | C12H14INO |
|---|---|
| Molecular weight | 315.15 g/mol |
| IUPAC name | (5-iodo-2-methylphenyl)-pyrrolidin-1-ylmethanone |
| InChIKey | HBQMCKIVMYXBSM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)I)C(=O)N2CCCC2 |
Computed by PubChem (NCBI)