CAS 1228778-59-3 appears in our catalog under these names: 2-Iodotriphenylene, 95%, 2-Iodotriphenylene, 98%, 2–Iodotriphenylene, 2-Iodotriphenylene, >98.0%(GC), 2-Iodotriphenylene, ≥98%(GC), ≥98%(GC). Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 200mg, 1g, 5g, 50mg.
2-iodotriphenylene (CAS 1228778-59-3) is a chemical compound with the molecular formula C18H11I and a molecular weight of 354.2 g/mol. IUPAC name: 2-iodotriphenylene. InChIKey: ZMZNYRZSJDYTIO-UHFFFAOYSA-N.
| Molecular formula | C18H11I |
|---|---|
| Molecular weight | 354.2 g/mol |
| IUPAC name | 2-iodotriphenylene |
| InChIKey | ZMZNYRZSJDYTIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=C(C=C3)I)C4=CC=CC=C24 |
Computed by PubChem (NCBI)