Products 1228813-89-5
CAS 1228813-89-5 appears in our catalog under these names: 2,3,4,5-Tetrafluoro-6-iodoaniline 95%, 2,3,4,5-Tetrafluoro-6-iodoaniline, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,3,4,5-tetrafluoro-6-iodoaniline (CAS 1228813-89-5) is a chemical compound with the molecular formula C6H2F4IN and a molecular weight of 290.98 g/mol. IUPAC name: 2,3,4,5-tetrafluoro-6-iodoaniline. InChIKey: CJAYCTZFMUEVOD-UHFFFAOYSA-N.
| Molecular formula | C6H2F4IN |
|---|---|
| Molecular weight | 290.98 g/mol |
| IUPAC name | 2,3,4,5-tetrafluoro-6-iodoaniline |
| InChIKey | CJAYCTZFMUEVOD-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1I)F)F)F)F)N |
Computed by PubChem (NCBI)