CAS 122883-93-6 appears in our catalog under these names: Ziprasidone hydrochloride, 97%, Ziprasidone HCl, Ziprasidone HCl, Ziprasidone hydrochloride, 98%, 98%, Ziprasidone (hydrochloride), 99.74%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10g, 100g, 25g, 5g, 1g, on request, 100mg, 10mM (in 1ml dmso).
5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one;hydrochloride (CAS 122883-93-6) is a chemical compound with the molecular formula C21H22Cl2N4OS and a molecular weight of 449.4 g/mol. IUPAC name: 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one;hydrochloride. InChIKey: NZDBKBRIBJLNNT-UHFFFAOYSA-N.
| Molecular formula | C21H22Cl2N4OS |
|---|---|
| Molecular weight | 449.4 g/mol |
| IUPAC name | 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | NZDBKBRIBJLNNT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCC2=C(C=C3C(=C2)CC(=O)N3)Cl)C4=NSC5=CC=CC=C54.Cl |
Computed by PubChem (NCBI)