CAS 1228956-93-1 appears in our catalog under these names: 1-Bromo-3-chloro-2,4-dimethoxybenzene, 97%, 1-Bromo-3-chloro-2,4-dimethoxybenzene 97%, 1-Bromo-3-chloro-2,4-dimethoxybenzene, 95%+, 95%+. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
1-bromo-3-chloro-2,4-dimethoxybenzene (CAS 1228956-93-1) is a chemical compound with the molecular formula C8H8BrClO2 and a molecular weight of 251.50 g/mol. IUPAC name: 1-bromo-3-chloro-2,4-dimethoxybenzene. InChIKey: UWFOXBKVWIZPQJ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO2 |
|---|---|
| Molecular weight | 251.50 g/mol |
| IUPAC name | 1-bromo-3-chloro-2,4-dimethoxybenzene |
| InChIKey | UWFOXBKVWIZPQJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)OC)Cl |
Computed by PubChem (NCBI)