CAS 1228957-08-1 is the registry number for 3-(1-(tert-Butyldimethylsilyl)-1H-indol-5-yl)benzoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
3-[1-[tert-butyl(dimethyl)silyl]indol-5-yl]benzoic acid (CAS 1228957-08-1) is a chemical compound with the molecular formula C21H25NO2Si and a molecular weight of 351.5 g/mol. IUPAC name: 3-[1-[tert-butyl(dimethyl)silyl]indol-5-yl]benzoic acid. InChIKey: HDBCXDRSFKQAAL-UHFFFAOYSA-N.
| Molecular formula | C21H25NO2Si |
|---|---|
| Molecular weight | 351.5 g/mol |
| IUPAC name | 3-[1-[tert-butyl(dimethyl)silyl]indol-5-yl]benzoic acid |
| InChIKey | HDBCXDRSFKQAAL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)N1C=CC2=C1C=CC(=C2)C3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)