Products 1228957-08-1

CAS 1228957-08-1 is the registry number for 3-(1-(tert-Butyldimethylsilyl)-1H-indol-5-yl)benzoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-[1-[tert-butyl(dimethyl)silyl]indol-5-yl]benzoic acid (CAS 1228957-08-1) is a chemical compound with the molecular formula C21H25NO2Si and a molecular weight of 351.5 g/mol. IUPAC name: 3-[1-[tert-butyl(dimethyl)silyl]indol-5-yl]benzoic acid. InChIKey: HDBCXDRSFKQAAL-UHFFFAOYSA-N.

Identity
Molecular formulaC21H25NO2Si
Molecular weight351.5 g/mol
IUPAC name3-[1-[tert-butyl(dimethyl)silyl]indol-5-yl]benzoic acid
InChIKeyHDBCXDRSFKQAAL-UHFFFAOYSA-N
SMILESCC(C)(C)[Si](C)(C)N1C=CC2=C1C=CC(=C2)C3=CC(=CC=C3)C(=O)O

Computed by PubChem (NCBI)