CAS 1229355-35-4 appears in our catalog under these names: Darifenacin Impurity 9, (R)-2,2-Diphenyl-2-(pyrrolidin-3-yl)acetonitrile Hydrobromide. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 50mg, 25mg.
2,2-diphenyl-2-[(3R)-pyrrolidin-3-yl]acetonitrile;hydrobromide (CAS 1229355-35-4) is a chemical compound with the molecular formula C18H19BrN2 and a molecular weight of 343.3 g/mol. IUPAC name: 2,2-diphenyl-2-[(3R)-pyrrolidin-3-yl]acetonitrile;hydrobromide. InChIKey: LJVBBQWRRWKVJD-LMOVPXPDSA-N.
| Molecular formula | C18H19BrN2 |
|---|---|
| Molecular weight | 343.3 g/mol |
| IUPAC name | 2,2-diphenyl-2-[(3R)-pyrrolidin-3-yl]acetonitrile;hydrobromide |
| InChIKey | LJVBBQWRRWKVJD-LMOVPXPDSA-N |
| SMILES | C1CNC[C@H]1C(C#N)(C2=CC=CC=C2)C3=CC=CC=C3.Br |
Computed by PubChem (NCBI)