CAS 1229442-50-5 is the registry number for 2-(3-(3-Bromopropoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[3-(3-bromopropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1229442-50-5) is a chemical compound with the molecular formula C15H22BBrO3 and a molecular weight of 341.1 g/mol. IUPAC name: 2-[3-(3-bromopropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MSWCZRWNRNZNPM-UHFFFAOYSA-N.
| Molecular formula | C15H22BBrO3 |
|---|---|
| Molecular weight | 341.1 g/mol |
| IUPAC name | 2-[3-(3-bromopropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MSWCZRWNRNZNPM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCCCBr |
Computed by PubChem (NCBI)