CAS 12295-69-1 is the registry number for (4-Methoxy-1,4-dioxobutyl)ferrocene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Cyclopenta-1,3-diene;iron(2+);methyl 4-cyclopenta-2,4-dien-1-yl-4-oxobutanoate (CAS 12295-69-1) is a chemical compound with the molecular formula C15H8FeO3-8 and a molecular weight of 292.07 g/mol. IUPAC name: cyclopenta-1,3-diene;iron(2+);methyl 4-cyclopenta-2,4-dien-1-yl-4-oxobutanoate. InChIKey: PXCMBEDCVOMRCX-UHFFFAOYSA-N.
| Molecular formula | C15H8FeO3-8 |
|---|---|
| Molecular weight | 292.07 g/mol |
| IUPAC name | cyclopenta-1,3-diene;iron(2+);methyl 4-cyclopenta-2,4-dien-1-yl-4-oxobutanoate |
| InChIKey | PXCMBEDCVOMRCX-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(=O)[C-]1[C-]=[C-][C-]=[C-]1.[CH-]1[C-]=[C-][C-]=[C-]1.[Fe+2] |
Computed by PubChem (NCBI)