CAS 122955-13-9 appears in our catalog under these names: XE 991 Dihydrochloride, >95% (HPLC), XE 991 dihydrochloride/ 98.96% (existing batch purity), XE 991 dihydrochloride, XE 991 dihydrochloride, 10,10-Bis(pyridin-4-ylmethyl)anthracen-9(10H)-one dihydrochloride, 99%, 99%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 10mg, 1mg, 5mg, 25mg, 50mg, 250mg, 100 mg.
10,10-bis(pyridin-4-ylmethyl)anthracen-9-one;dihydrochloride (CAS 122955-13-9) is a chemical compound with the molecular formula C26H22Cl2N2O and a molecular weight of 449.4 g/mol. IUPAC name: 10,10-bis(pyridin-4-ylmethyl)anthracen-9-one;dihydrochloride. InChIKey: WOGWMARIFDNZON-UHFFFAOYSA-N.
| Molecular formula | C26H22Cl2N2O |
|---|---|
| Molecular weight | 449.4 g/mol |
| IUPAC name | 10,10-bis(pyridin-4-ylmethyl)anthracen-9-one;dihydrochloride |
| InChIKey | WOGWMARIFDNZON-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3C2(CC4=CC=NC=C4)CC5=CC=NC=C5.Cl.Cl |
Computed by PubChem (NCBI)