Products 1229571-00-9
CAS 1229571-00-9 appears in our catalog under these names: BODIPY FL Ethylamine, 98.06%, BODIPY FL Ethylamine, 98%. Offered by: MedChemExpress, Ambeed. Available pack sizes: 10 mg, 100 mg, 25 mg, 50 mg, 5 mg, 100mg, 250mg.
2-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)ethanamine (CAS 1229571-00-9) is a chemical compound with the molecular formula C15H20BF2N3 and a molecular weight of 291.15 g/mol. IUPAC name: 2-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)ethanamine. InChIKey: SZJISQYFKXZBOV-UHFFFAOYSA-N.
| Molecular formula | C15H20BF2N3 |
|---|---|
| Molecular weight | 291.15 g/mol |
| IUPAC name | 2-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)ethanamine |
| InChIKey | SZJISQYFKXZBOV-UHFFFAOYSA-N |
| SMILES | [B-]1(N2C(=CC(=C2C(=C3[N+]1=C(C=C3C)C)CCN)C)C)(F)F |
Computed by PubChem (NCBI)
Synonyms:
BODIPY FL Ethylamine