CAS 1229582-33-5 appears in our catalog under these names: URMC–099, URMC-099, URMC-099/ 99.32% (existing batch purity), URMC 099, 3-(1H-Indol-5-yl)-5-(4-((4-methylpiperazin-1-yl)methyl)phenyl)-1H-pyrrolo[2,3-b]pyridine, 99%, 99%. Offered by: GLPBio, Chemat Brand, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, on request, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
3-(1H-indol-5-yl)-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1H-pyrrolo[2,3-b]pyridine (CAS 1229582-33-5) is a chemical compound with the molecular formula C27H27N5 and a molecular weight of 421.5 g/mol. IUPAC name: 3-(1H-indol-5-yl)-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1H-pyrrolo[2,3-b]pyridine. InChIKey: QKKIWEILHCXECO-UHFFFAOYSA-N.
| Molecular formula | C27H27N5 |
|---|---|
| Molecular weight | 421.5 g/mol |
| IUPAC name | 3-(1H-indol-5-yl)-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | QKKIWEILHCXECO-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC=C(C=C2)C3=CC4=C(NC=C4C5=CC6=C(C=C5)NC=C6)N=C3 |
Computed by PubChem (NCBI)