CAS 1229603-71-7 appears in our catalog under these names: 2,7-Dibromo-9,9-difluoro-9h-fluorene, 97%, 2,7–Dibromo–9,9–difluorofluorene, 2,7-Dibromo-9,9-difluorofluorene, >97.0%(GC), 2,7-Dibromo-9,9-difluoro-9H-fluorene, 95%, 95%, 9H-FLUORENE, 2,7-DIBROMO-9,9-DIFLUORO-, ≥95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 200mg.
2,7-dibromo-9,9-difluorofluorene (CAS 1229603-71-7) is a chemical compound with the molecular formula C13H6Br2F2 and a molecular weight of 359.99 g/mol. IUPAC name: 2,7-dibromo-9,9-difluorofluorene. InChIKey: ITRVPZLDBPKHTI-UHFFFAOYSA-N.
| Molecular formula | C13H6Br2F2 |
|---|---|
| Molecular weight | 359.99 g/mol |
| IUPAC name | 2,7-dibromo-9,9-difluorofluorene |
| InChIKey | ITRVPZLDBPKHTI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(C3=C2C=CC(=C3)Br)(F)F |
Computed by PubChem (NCBI)