CAS 122970-50-7 is the registry number for 2,5,7-Trichlorothiazolo(4,5-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 0,5g, 1g, 2g, 5g.
2,5,7-trichloro-[1,3]thiazolo[4,5-d]pyrimidine (CAS 122970-50-7) is a chemical compound with the molecular formula C5Cl3N3S and a molecular weight of 240.5 g/mol. IUPAC name: 2,5,7-trichloro-[1,3]thiazolo[4,5-d]pyrimidine. InChIKey: HIWGATGOXMCBBI-UHFFFAOYSA-N.
| Molecular formula | C5Cl3N3S |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | 2,5,7-trichloro-[1,3]thiazolo[4,5-d]pyrimidine |
| InChIKey | HIWGATGOXMCBBI-UHFFFAOYSA-N |
| SMILES | C12=C(N=C(N=C1Cl)Cl)N=C(S2)Cl |
Computed by PubChem (NCBI)