CAS 123016-21-7 is the registry number for WY-50295. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[6-(quinolin-2-ylmethoxy)naphthalen-2-yl]propanoic acid (CAS 123016-21-7) is a chemical compound with the molecular formula C23H19NO3 and a molecular weight of 357.4 g/mol. IUPAC name: (2S)-2-[6-(quinolin-2-ylmethoxy)naphthalen-2-yl]propanoic acid. InChIKey: QWFAMXAVDCZEBZ-HNNXBMFYSA-N.
| Molecular formula | C23H19NO3 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (2S)-2-[6-(quinolin-2-ylmethoxy)naphthalen-2-yl]propanoic acid |
| InChIKey | QWFAMXAVDCZEBZ-HNNXBMFYSA-N |
| SMILES | C[C@@H](C1=CC2=C(C=C1)C=C(C=C2)OCC3=NC4=CC=CC=C4C=C3)C(=O)O |
Computed by PubChem (NCBI)