CAS 123151-14-4 is the registry number for Sodium 3,5-dimethylisoxazole-4-sulfinate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 3,5-dimethyl-1,2-oxazole-4-sulfinate (CAS 123151-14-4) is a chemical compound with the molecular formula C5H6NNaO3S and a molecular weight of 183.16 g/mol. IUPAC name: sodium 3,5-dimethyl-1,2-oxazole-4-sulfinate. InChIKey: AJMIJVVNGPWHSH-UHFFFAOYSA-M.
| Molecular formula | C5H6NNaO3S |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | sodium 3,5-dimethyl-1,2-oxazole-4-sulfinate |
| InChIKey | AJMIJVVNGPWHSH-UHFFFAOYSA-M |
| SMILES | CC1=C(C(=NO1)C)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)