CAS 1231710-68-1 appears in our catalog under these names: Metazachlor Impurity 5, Metazachlor Ethane Sulfonic Acid Sodium Salt, Metazachlor ESA sodium salt, Metazachlor ESA sodium salt, Concentration: 100 µg/ml Solvent: Acetonitrile, Metazachlor ESA sodium salt, Concentration: 10.0 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, HPC Standards. Available pack sizes: on request, 10mg, 25mg, 50mg, 1x10mg, 1x1ml, 1x10ml.
Sodium 2-[2,6-dimethyl-N-(pyrazol-1-ylmethyl)anilino]-2-oxoethanesulfonate (CAS 1231710-68-1) is a chemical compound with the molecular formula C14H16N3NaO4S and a molecular weight of 345.35 g/mol. IUPAC name: sodium 2-[2,6-dimethyl-N-(pyrazol-1-ylmethyl)anilino]-2-oxoethanesulfonate. InChIKey: PCVFIVBODVWPQX-UHFFFAOYSA-M.
| Molecular formula | C14H16N3NaO4S |
|---|---|
| Molecular weight | 345.35 g/mol |
| IUPAC name | sodium 2-[2,6-dimethyl-N-(pyrazol-1-ylmethyl)anilino]-2-oxoethanesulfonate |
| InChIKey | PCVFIVBODVWPQX-UHFFFAOYSA-M |
| SMILES | CC1=C(C(=CC=C1)C)N(CN2C=CC=N2)C(=O)CS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)