CAS 1231930-34-9 is the registry number for 6-Bromo-1-cyclopropyl-4-fluoro-2-methyl-1H-benzimidazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g.
6-bromo-1-cyclopropyl-4-fluoro-2-methylbenzimidazole (CAS 1231930-34-9) is a chemical compound with the molecular formula C11H10BrFN2 and a molecular weight of 269.11 g/mol. IUPAC name: 6-bromo-1-cyclopropyl-4-fluoro-2-methylbenzimidazole. InChIKey: JRMBZZYRXVFIDK-UHFFFAOYSA-N.
| Molecular formula | C11H10BrFN2 |
|---|---|
| Molecular weight | 269.11 g/mol |
| IUPAC name | 6-bromo-1-cyclopropyl-4-fluoro-2-methylbenzimidazole |
| InChIKey | JRMBZZYRXVFIDK-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C3CC3)C=C(C=C2F)Br |
Computed by PubChem (NCBI)