CAS 1231930-57-6 appears in our catalog under these names: Des-Et-Abemaciclib, LSN2839567/ 99.14% (existing batch purity), Abemaciclib metabolite M2 98%, Des-Et-Abemaciclib, 98%, 98%, Abemaciclib metabolite M2, 99.75%. Offered by: TRC, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 250mg, 25 mg.
5-fluoro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)-N-[5-(piperazin-1-ylmethyl)-2-pyridinyl]pyrimidin-2-amine (CAS 1231930-57-6) is a chemical compound with the molecular formula C25H28F2N8 and a molecular weight of 478.5 g/mol. IUPAC name: 5-fluoro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)-N-[5-(piperazin-1-ylmethyl)-2-pyridinyl]pyrimidin-2-amine. InChIKey: IXGZDCRFGCEEBU-UHFFFAOYSA-N.
| Molecular formula | C25H28F2N8 |
|---|---|
| Molecular weight | 478.5 g/mol |
| IUPAC name | 5-fluoro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)-N-[5-(piperazin-1-ylmethyl)-2-pyridinyl]pyrimidin-2-amine |
| InChIKey | IXGZDCRFGCEEBU-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C(C)C)C=C(C=C2F)C3=NC(=NC=C3F)NC4=NC=C(C=C4)CN5CCNCC5 |
Computed by PubChem (NCBI)