CAS 1231947-90-2 appears in our catalog under these names: Cariprazine Impurity 4, Cariprazine Impurity 6, trans-N-(4-(2-(4-(2,3-Dichlorophenyl)piperazin-1-yl)ethyl)cyclohexyl)carbamic Acid Isopropyl Ester. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
Propan-2-yl N-[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]carbamate (CAS 1231947-90-2) is a chemical compound with the molecular formula C22H33Cl2N3O2 and a molecular weight of 442.4 g/mol. IUPAC name: propan-2-yl N-[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]carbamate. InChIKey: WZSUCHUYLQMKGD-UHFFFAOYSA-N.
| Molecular formula | C22H33Cl2N3O2 |
|---|---|
| Molecular weight | 442.4 g/mol |
| IUPAC name | propan-2-yl N-[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]carbamate |
| InChIKey | WZSUCHUYLQMKGD-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)NC1CCC(CC1)CCN2CCN(CC2)C3=C(C(=CC=C3)Cl)Cl |
Computed by PubChem (NCBI)