CAS 1231955-75-1 appears in our catalog under these names: 1-(Butyl(ethyl)carbamoyl)-3-methyl-1H-imidazol-3-ium iodide, 95%, 1–(butyl(ethyl)carbamoyl)–3–methyl–1h–imidazol–3–ium iodide, 1-(Butyl(ethyl)carbamoyl)-3-methyl-1H-imidazol-3-ium iodide. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 100mg, 1g, 2,5g, 250mg, 50mg, 500mg.
N-butyl-N-ethyl-3-methylimidazol-3-ium-1-carboxamide iodide (CAS 1231955-75-1) is a chemical compound with the molecular formula C11H20IN3O and a molecular weight of 337.20 g/mol. IUPAC name: N-butyl-N-ethyl-3-methylimidazol-3-ium-1-carboxamide iodide. InChIKey: KJVMAEWZMIBUII-UHFFFAOYSA-M.
| Molecular formula | C11H20IN3O |
|---|---|
| Molecular weight | 337.20 g/mol |
| IUPAC name | N-butyl-N-ethyl-3-methylimidazol-3-ium-1-carboxamide iodide |
| InChIKey | KJVMAEWZMIBUII-UHFFFAOYSA-M |
| SMILES | CCCCN(CC)C(=O)N1C=C[N+](=C1)C.[I-] |
Computed by PubChem (NCBI)